About 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propyl-trimethylazanium chloride
3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propyl-trimethylazanium chloride (PubChem CID 155562366) has the molecular formula C11H22ClN3O2
and a molecular weight of 263.77 g/mol. Its IUPAC name is 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propyl-trimethylazanium chloride.
Molecular Properties
| Compound Name | 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propyl-trimethylazanium chloride |
| PubChem CID | 155562366 |
| Molecular Formula | C11H22ClN3O2 |
| Molecular Weight | 263.77 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propyl-trimethylazanium chloride |
| SMILES | CC1(C)NC(=O)N(CCC[N+](C)(C)C)C1=O.[Cl-] |
| InChI | InChI=1S/C11H21N3O2.ClH/c1-11(2)9(15)13(10(16)12-11)7-6-8-14(3,4)5;/h6-8H2,1-5H3;1H |
| InChIKey | SYOVBNKIPJULTJ-UHFFFAOYSA-N |
| XLogP | -2.58 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.77 |
| LogP ≤ 5 | -2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propyl-trimethylazanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propyl-trimethylazanium chloride?
The IUPAC name of 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propyl-trimethylazanium chloride (CID 155562366) is 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propyl-trimethylazanium chloride.
What is the SMILES notation for 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propyl-trimethylazanium chloride?
The canonical SMILES for 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propyl-trimethylazanium chloride is CC1(C)NC(=O)N(CCC[N+](C)(C)C)C1=O.[Cl-].
What is the InChIKey of 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propyl-trimethylazanium chloride?
The InChIKey is SYOVBNKIPJULTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3O2.ClH/c1-11(2)9(15)13(10(16)12-11)7-6-8-14(3,4)5;/h6-8H2,1-5H3;1H.
What are the key properties of 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propyl-trimethylazanium chloride?
3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propyl-trimethylazanium chloride has a molecular weight of 263.77 g/mol, XLogP of -2.58, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propyl-trimethylazanium chloride is sourced from PubChem (CID 155562366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).