C8H13ClN2O2 — CID 10655825
3-(3-chloropropyl)-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 10655825) has the molecular formula C8H13ClN2O2 and a molecular weight of 204.66 g/mol. Its IUPAC name is 3-(3-chloropropyl)-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-(3-chloropropyl)-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 10655825 |
| Molecular Formula | C8H13ClN2O2 |
| Molecular Weight | 204.66 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 3-(3-chloropropyl)-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CC1(C)NC(=O)N(CCCCl)C1=O |
| InChI | InChI=1S/C8H13ClN2O2/c1-8(2)6(12)11(5-3-4-9)7(13)10-8/h3-5H2,1-2H3,(H,10,13) |
| InChIKey | LCZJREYWIOXGGW-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.66 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|