C21H25N7OS — CID 155562709
1-[6-[(4-methylpiperidin-1-yl)methyl]-1,3-benzothiazol-2-yl]-3-[(E)-1-pyrazin-2-ylethylideneamino]urea (PubChem CID 155562709) has the molecular formula C21H25N7OS and a molecular weight of 423.55 g/mol. Its IUPAC name is 1-[6-[(4-methylpiperidin-1-yl)methyl]-1,3-benzothiazol-2-yl]-3-[(E)-1-pyrazin-2-ylethylideneamino]urea.
| Compound Name | 1-[6-[(4-methylpiperidin-1-yl)methyl]-1,3-benzothiazol-2-yl]-3-[(E)-1-pyrazin-2-ylethylideneamino]urea |
|---|---|
| PubChem CID | 155562709 |
| Molecular Formula | C21H25N7OS |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 1-[6-[(4-methylpiperidin-1-yl)methyl]-1,3-benzothiazol-2-yl]-3-[(E)-1-pyrazin-2-ylethylideneamino]urea |
| SMILES | C/C(=N\NC(=O)Nc1nc2ccc(CN3CCC(C)CC3)cc2s1)c1cnccn1 |
| InChI | InChI=1S/C21H25N7OS/c1-14-5-9-28(10-6-14)13-16-3-4-17-19(11-16)30-21(24-17)25-20(29)27-26-15(2)18-12-22-7-8-23-18/h3-4,7-8,11-12,14H,5-6,9-10,13H2,1-2H3,(H2,24,25,27,29)/b26-15+ |
| InChIKey | OJZLAQLJJHYHKH-CVKSISIWSA-N |
| XLogP | 3.86 |
| TPSA | 95.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|