C21H17ClN2O4S2 — CID 155563479
6-chloro-2-(4-methylsulfonylphenyl)-3-(2-nitro-1-thiophen-2-ylethyl)-1H-indole (PubChem CID 155563479) has the molecular formula C21H17ClN2O4S2 and a molecular weight of 460.96 g/mol. Its IUPAC name is 6-chloro-2-(4-methylsulfonylphenyl)-3-(2-nitro-1-thiophen-2-ylethyl)-1H-indole.
| Compound Name | 6-chloro-2-(4-methylsulfonylphenyl)-3-(2-nitro-1-thiophen-2-ylethyl)-1H-indole |
|---|---|
| PubChem CID | 155563479 |
| Molecular Formula | C21H17ClN2O4S2 |
| Molecular Weight | 460.96 g/mol |
| Exact Mass | 460.03 |
| IUPAC Name | 6-chloro-2-(4-methylsulfonylphenyl)-3-(2-nitro-1-thiophen-2-ylethyl)-1H-indole |
| SMILES | CS(=O)(=O)c1ccc(-c2[nH]c3cc(Cl)ccc3c2C(C[N+](=O)[O-])c2cccs2)cc1 |
| InChI | InChI=1S/C21H17ClN2O4S2/c1-30(27,28)15-7-4-13(5-8-15)21-20(16-9-6-14(22)11-18(16)23-21)17(12-24(25)26)19-3-2-10-29-19/h2-11,17,23H,12H2,1H3 |
| InChIKey | UFPUQCFZHNMRLY-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 93.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.96 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|