C32H36N6O6 — CID 155564632
2-[[[(2S)-2-[[(2R)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]-methylamino]propanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-(furan-2-yl)methyl]prop-2-enamide (PubChem CID 155564632) has the molecular formula C32H36N6O6 and a molecular weight of 600.68 g/mol. Its IUPAC name is 2-[[[(2S)-2-[[(2R)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]-methylamino]propanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-(furan-2-yl)methyl]prop-2-enamide.
| Compound Name | 2-[[[(2S)-2-[[(2R)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]-methylamino]propanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-(furan-2-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 155564632 |
| Molecular Formula | C32H36N6O6 |
| Molecular Weight | 600.68 g/mol |
| Exact Mass | 600.27 |
| IUPAC Name | 2-[[[(2S)-2-[[(2R)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]-methylamino]propanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-(furan-2-yl)methyl]prop-2-enamide |
| SMILES | C=C(C(N)=O)C(NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@@H](C)N(C)C(=O)[C@@H](N)Cc1ccc(O)cc1)c1ccco1 |
| InChI | InChI=1S/C32H36N6O6/c1-18(29(34)40)28(27-9-6-14-44-27)37-31(42)26(16-21-17-35-25-8-5-4-7-23(21)25)36-30(41)19(2)38(3)32(43)24(33)15-20-10-12-22(39)13-11-20/h4-14,17,19,24,26,28,35,39H,1,15-16,33H2,2-3H3,(H2,34,40)(H,36,41)(H,37,42)/t19-,24+,26+,28?/m1/s1 |
| InChIKey | NGQDZGVKQZOSOP-DMLANQKZSA-N |
| XLogP | 1.81 |
| TPSA | 196.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.68 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|