C26H31N5O6S — CID 18261629
2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]propanoic acid (PubChem CID 18261629) has the molecular formula C26H31N5O6S and a molecular weight of 541.63 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]propanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 18261629 |
| Molecular Formula | C26H31N5O6S |
| Molecular Weight | 541.63 g/mol |
| Exact Mass | 541.20 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]propanoic acid |
| SMILES | CC(NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(N)CS)C(=O)O |
| InChI | InChI=1S/C26H31N5O6S/c1-14(26(36)37)29-24(34)21(10-15-6-8-17(32)9-7-15)31-25(35)22(30-23(33)19(27)13-38)11-16-12-28-20-5-3-2-4-18(16)20/h2-9,12,14,19,21-22,28,32,38H,10-11,13,27H2,1H3,(H,29,34)(H,30,33)(H,31,35)(H,36,37) |
| InChIKey | IIRDBTXKBYSVBH-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 186.64 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.63 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|