C10H14NO7PS — CID 155565062
[[2-(hydroxyamino)-2-oxoethyl]sulfonyl-(4-methylphenyl)methyl]phosphonic acid (PubChem CID 155565062) has the molecular formula C10H14NO7PS and a molecular weight of 323.26 g/mol. Its IUPAC name is [[2-(hydroxyamino)-2-oxoethyl]sulfonyl-(4-methylphenyl)methyl]phosphonic acid.
| Compound Name | [[2-(hydroxyamino)-2-oxoethyl]sulfonyl-(4-methylphenyl)methyl]phosphonic acid |
|---|---|
| PubChem CID | 155565062 |
| Molecular Formula | C10H14NO7PS |
| Molecular Weight | 323.26 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | [[2-(hydroxyamino)-2-oxoethyl]sulfonyl-(4-methylphenyl)methyl]phosphonic acid |
| SMILES | Cc1ccc(C(P(=O)(O)O)S(=O)(=O)CC(=O)NO)cc1 |
| InChI | InChI=1S/C10H14NO7PS/c1-7-2-4-8(5-3-7)10(19(14,15)16)20(17,18)6-9(12)11-13/h2-5,10,13H,6H2,1H3,(H,11,12)(H2,14,15,16) |
| InChIKey | BULHMCQXTNNNEM-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 141.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.26 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|