C10H12F2NO7PS — CID 155528740
[(3,5-difluorophenyl)-[2-[hydroxy(methyl)amino]-2-oxoethyl]sulfonylmethyl]phosphonic acid (PubChem CID 155528740) has the molecular formula C10H12F2NO7PS and a molecular weight of 359.24 g/mol. Its IUPAC name is [(3,5-difluorophenyl)-[2-[hydroxy(methyl)amino]-2-oxoethyl]sulfonylmethyl]phosphonic acid.
| Compound Name | [(3,5-difluorophenyl)-[2-[hydroxy(methyl)amino]-2-oxoethyl]sulfonylmethyl]phosphonic acid |
|---|---|
| PubChem CID | 155528740 |
| Molecular Formula | C10H12F2NO7PS |
| Molecular Weight | 359.24 g/mol |
| Exact Mass | 359.00 |
| IUPAC Name | [(3,5-difluorophenyl)-[2-[hydroxy(methyl)amino]-2-oxoethyl]sulfonylmethyl]phosphonic acid |
| SMILES | CN(O)C(=O)CS(=O)(=O)C(c1cc(F)cc(F)c1)P(=O)(O)O |
| InChI | InChI=1S/C10H12F2NO7PS/c1-13(15)9(14)5-22(19,20)10(21(16,17)18)6-2-7(11)4-8(12)3-6/h2-4,10,15H,5H2,1H3,(H2,16,17,18) |
| InChIKey | UUQUCESUGTXANS-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 132.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.24 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|