C20H22FN5O4 — CID 155565475
tert-butyl 4-[1-(4-cyano-2-fluorophenyl)triazole-4-carbonyl]oxypiperidine-1-carboxylate (PubChem CID 155565475) has the molecular formula C20H22FN5O4 and a molecular weight of 415.43 g/mol. Its IUPAC name is tert-butyl 4-[1-(4-cyano-2-fluorophenyl)triazole-4-carbonyl]oxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-(4-cyano-2-fluorophenyl)triazole-4-carbonyl]oxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 155565475 |
| Molecular Formula | C20H22FN5O4 |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | tert-butyl 4-[1-(4-cyano-2-fluorophenyl)triazole-4-carbonyl]oxypiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(OC(=O)c2cn(-c3ccc(C#N)cc3F)nn2)CC1 |
| InChI | InChI=1S/C20H22FN5O4/c1-20(2,3)30-19(28)25-8-6-14(7-9-25)29-18(27)16-12-26(24-23-16)17-5-4-13(11-22)10-15(17)21/h4-5,10,12,14H,6-9H2,1-3H3 |
| InChIKey | TWNKGUPFYBNQMT-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 110.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |