C28H27N7O2 — CID 155565735
8-[(1-methylimidazol-2-yl)methyl]-3-(4-phenylphenyl)-1-pyrimidin-2-yl-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 155565735) has the molecular formula C28H27N7O2 and a molecular weight of 493.57 g/mol. Its IUPAC name is 8-[(1-methylimidazol-2-yl)methyl]-3-(4-phenylphenyl)-1-pyrimidin-2-yl-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-[(1-methylimidazol-2-yl)methyl]-3-(4-phenylphenyl)-1-pyrimidin-2-yl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 155565735 |
| Molecular Formula | C28H27N7O2 |
| Molecular Weight | 493.57 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | 8-[(1-methylimidazol-2-yl)methyl]-3-(4-phenylphenyl)-1-pyrimidin-2-yl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | Cn1ccnc1CN1CCC2(CC1)C(=O)N(c1ccc(-c3ccccc3)cc1)C(=O)N2c1ncccn1 |
| InChI | InChI=1S/C28H27N7O2/c1-32-19-16-29-24(32)20-33-17-12-28(13-18-33)25(36)34(27(37)35(28)26-30-14-5-15-31-26)23-10-8-22(9-11-23)21-6-3-2-4-7-21/h2-11,14-16,19H,12-13,17-18,20H2,1H3 |
| InChIKey | XFDLXPQRAGQNLN-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 87.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.57 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|