About 1-[4-[2-(4-fluorophenyl)imidazo[1,2-a]pyrimidin-7-yl]-1,4-diazepan-1-yl]ethanone
1-[4-[2-(4-fluorophenyl)imidazo[1,2-a]pyrimidin-7-yl]-1,4-diazepan-1-yl]ethanone (PubChem CID 155566559) has the molecular formula C19H20FN5O
and a molecular weight of 353.40 g/mol. Its IUPAC name is 1-[4-[2-(4-fluorophenyl)imidazo[1,2-a]pyrimidin-7-yl]-1,4-diazepan-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[4-[2-(4-fluorophenyl)imidazo[1,2-a]pyrimidin-7-yl]-1,4-diazepan-1-yl]ethanone |
| PubChem CID | 155566559 |
| Molecular Formula | C19H20FN5O |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 1-[4-[2-(4-fluorophenyl)imidazo[1,2-a]pyrimidin-7-yl]-1,4-diazepan-1-yl]ethanone |
| SMILES | CC(=O)N1CCCN(c2ccn3cc(-c4ccc(F)cc4)nc3n2)CC1 |
| InChI | InChI=1S/C19H20FN5O/c1-14(26)23-8-2-9-24(12-11-23)18-7-10-25-13-17(21-19(25)22-18)15-3-5-16(20)6-4-15/h3-7,10,13H,2,8-9,11-12H2,1H3 |
| InChIKey | XWEUCDXQARJJIK-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 53.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[4-[2-(4-fluorophenyl)imidazo[1,2-a]pyrimidin-7-yl]-1,4-diazepan-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[2-(4-fluorophenyl)imidazo[1,2-a]pyrimidin-7-yl]-1,4-diazepan-1-yl]ethanone?
The IUPAC name of 1-[4-[2-(4-fluorophenyl)imidazo[1,2-a]pyrimidin-7-yl]-1,4-diazepan-1-yl]ethanone (CID 155566559) is 1-[4-[2-(4-fluorophenyl)imidazo[1,2-a]pyrimidin-7-yl]-1,4-diazepan-1-yl]ethanone.
What is the SMILES notation for 1-[4-[2-(4-fluorophenyl)imidazo[1,2-a]pyrimidin-7-yl]-1,4-diazepan-1-yl]ethanone?
The canonical SMILES for 1-[4-[2-(4-fluorophenyl)imidazo[1,2-a]pyrimidin-7-yl]-1,4-diazepan-1-yl]ethanone is CC(=O)N1CCCN(c2ccn3cc(-c4ccc(F)cc4)nc3n2)CC1.
What is the InChIKey of 1-[4-[2-(4-fluorophenyl)imidazo[1,2-a]pyrimidin-7-yl]-1,4-diazepan-1-yl]ethanone?
The InChIKey is XWEUCDXQARJJIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20FN5O/c1-14(26)23-8-2-9-24(12-11-23)18-7-10-25-13-17(21-19(25)22-18)15-3-5-16(20)6-4-15/h3-7,10,13H,2,8-9,11-12H2,1H3.
What are the key properties of 1-[4-[2-(4-fluorophenyl)imidazo[1,2-a]pyrimidin-7-yl]-1,4-diazepan-1-yl]ethanone?
1-[4-[2-(4-fluorophenyl)imidazo[1,2-a]pyrimidin-7-yl]-1,4-diazepan-1-yl]ethanone has a molecular weight of 353.40 g/mol, XLogP of 2.59, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[2-(4-fluorophenyl)imidazo[1,2-a]pyrimidin-7-yl]-1,4-diazepan-1-yl]ethanone is sourced from PubChem (CID 155566559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).