C42H35BF4N2 — CID 155568024
4-(3,4-diphenyl-2-propylisoquinolin-2-ium-6-yl)-N,N-diphenylaniline tetrafluoroborate (PubChem CID 155568024) has the molecular formula C42H35BF4N2 and a molecular weight of 654.56 g/mol. Its IUPAC name is 4-(3,4-diphenyl-2-propylisoquinolin-2-ium-6-yl)-N,N-diphenylaniline tetrafluoroborate.
| Compound Name | 4-(3,4-diphenyl-2-propylisoquinolin-2-ium-6-yl)-N,N-diphenylaniline tetrafluoroborate |
|---|---|
| PubChem CID | 155568024 |
| Molecular Formula | C42H35BF4N2 |
| Molecular Weight | 654.56 g/mol |
| Exact Mass | 654.28 |
| IUPAC Name | 4-(3,4-diphenyl-2-propylisoquinolin-2-ium-6-yl)-N,N-diphenylaniline tetrafluoroborate |
| SMILES | CCC[n+]1cc2ccc(-c3ccc(N(c4ccccc4)c4ccccc4)cc3)cc2c(-c2ccccc2)c1-c1ccccc1.F[B-](F)(F)F |
| InChI | InChI=1S/C42H35N2.BF4/c1-2-29-43-31-36-24-23-35(30-40(36)41(33-15-7-3-8-16-33)42(43)34-17-9-4-10-18-34)32-25-27-39(28-26-32)44(37-19-11-5-12-20-37)38-21-13-6-14-22-38;2-1(3,4)5/h3-28,30-31H,2,29H2,1H3;/q+1;-1 |
| InChIKey | VXPFWBAYKWSTTE-UHFFFAOYSA-N |
| XLogP | 12.31 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.56 |
| LogP ≤ 5 | 12.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|