C22H19N5O3 — CID 155569001
ethyl 2-[6-[(3-phenylbenzoyl)amino]purin-9-yl]acetate (PubChem CID 155569001) has the molecular formula C22H19N5O3 and a molecular weight of 401.43 g/mol. Its IUPAC name is ethyl 2-[6-[(3-phenylbenzoyl)amino]purin-9-yl]acetate.
| Compound Name | ethyl 2-[6-[(3-phenylbenzoyl)amino]purin-9-yl]acetate |
|---|---|
| PubChem CID | 155569001 |
| Molecular Formula | C22H19N5O3 |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | ethyl 2-[6-[(3-phenylbenzoyl)amino]purin-9-yl]acetate |
| SMILES | CCOC(=O)Cn1cnc2c(NC(=O)c3cccc(-c4ccccc4)c3)ncnc21 |
| InChI | InChI=1S/C22H19N5O3/c1-2-30-18(28)12-27-14-25-19-20(23-13-24-21(19)27)26-22(29)17-10-6-9-16(11-17)15-7-4-3-5-8-15/h3-11,13-14H,2,12H2,1H3,(H,23,24,26,29) |
| InChIKey | UBFALLCUHFSASN-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |