C23H29N7O4 — CID 118374540
3-[9-[7-(hydroxyamino)-7-oxoheptyl]-6-morpholin-4-ylpurin-2-yl]benzamide (PubChem CID 118374540) has the molecular formula C23H29N7O4 and a molecular weight of 467.53 g/mol. Its IUPAC name is 3-[9-[7-(hydroxyamino)-7-oxoheptyl]-6-morpholin-4-ylpurin-2-yl]benzamide.
| Compound Name | 3-[9-[7-(hydroxyamino)-7-oxoheptyl]-6-morpholin-4-ylpurin-2-yl]benzamide |
|---|---|
| PubChem CID | 118374540 |
| Molecular Formula | C23H29N7O4 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.23 |
| IUPAC Name | 3-[9-[7-(hydroxyamino)-7-oxoheptyl]-6-morpholin-4-ylpurin-2-yl]benzamide |
| SMILES | NC(=O)c1cccc(-c2nc(N3CCOCC3)c3ncn(CCCCCCC(=O)NO)c3n2)c1 |
| InChI | InChI=1S/C23H29N7O4/c24-20(32)16-6-5-7-17(14-16)21-26-22(29-10-12-34-13-11-29)19-23(27-21)30(15-25-19)9-4-2-1-3-8-18(31)28-33/h5-7,14-15,33H,1-4,8-13H2,(H2,24,32)(H,28,31) |
| InChIKey | IERFGLSPELTWBZ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 148.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|