C24H31N7O4 — CID 118374539
7-[2-(3-acetamidophenyl)-6-morpholin-4-ylpurin-9-yl]-N-hydroxyheptanamide (PubChem CID 118374539) has the molecular formula C24H31N7O4 and a molecular weight of 481.56 g/mol. Its IUPAC name is 7-[2-(3-acetamidophenyl)-6-morpholin-4-ylpurin-9-yl]-N-hydroxyheptanamide.
| Compound Name | 7-[2-(3-acetamidophenyl)-6-morpholin-4-ylpurin-9-yl]-N-hydroxyheptanamide |
|---|---|
| PubChem CID | 118374539 |
| Molecular Formula | C24H31N7O4 |
| Molecular Weight | 481.56 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | 7-[2-(3-acetamidophenyl)-6-morpholin-4-ylpurin-9-yl]-N-hydroxyheptanamide |
| SMILES | CC(=O)Nc1cccc(-c2nc(N3CCOCC3)c3ncn(CCCCCCC(=O)NO)c3n2)c1 |
| InChI | InChI=1S/C24H31N7O4/c1-17(32)26-19-8-6-7-18(15-19)22-27-23(30-11-13-35-14-12-30)21-24(28-22)31(16-25-21)10-5-3-2-4-9-20(33)29-34/h6-8,15-16,34H,2-5,9-14H2,1H3,(H,26,32)(H,29,33) |
| InChIKey | AREJUGAYBXWFOK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 134.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.56 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|