C20H27N9O3 — CID 118366970
7-[6-(2-aminopyrimidin-5-yl)-2-morpholin-4-ylpurin-9-yl]-N-hydroxyheptanamide (PubChem CID 118366970) has the molecular formula C20H27N9O3 and a molecular weight of 441.50 g/mol. Its IUPAC name is 7-[6-(2-aminopyrimidin-5-yl)-2-morpholin-4-ylpurin-9-yl]-N-hydroxyheptanamide.
| Compound Name | 7-[6-(2-aminopyrimidin-5-yl)-2-morpholin-4-ylpurin-9-yl]-N-hydroxyheptanamide |
|---|---|
| PubChem CID | 118366970 |
| Molecular Formula | C20H27N9O3 |
| Molecular Weight | 441.50 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | 7-[6-(2-aminopyrimidin-5-yl)-2-morpholin-4-ylpurin-9-yl]-N-hydroxyheptanamide |
| SMILES | Nc1ncc(-c2nc(N3CCOCC3)nc3c2ncn3CCCCCCC(=O)NO)cn1 |
| InChI | InChI=1S/C20H27N9O3/c21-19-22-11-14(12-23-19)16-17-18(26-20(25-16)28-7-9-32-10-8-28)29(13-24-17)6-4-2-1-3-5-15(30)27-31/h11-13,31H,1-10H2,(H,27,30)(H2,21,22,23) |
| InChIKey | RWPSAJVRHXBADZ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 157.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.50 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|