C25H29BN4O4 — CID 155572835
methyl 5-[(4-anilino-5-methylpyrimidin-2-yl)amino]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (PubChem CID 155572835) has the molecular formula C25H29BN4O4 and a molecular weight of 460.34 g/mol. Its IUPAC name is methyl 5-[(4-anilino-5-methylpyrimidin-2-yl)amino]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate.
| Compound Name | methyl 5-[(4-anilino-5-methylpyrimidin-2-yl)amino]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
|---|---|
| PubChem CID | 155572835 |
| Molecular Formula | C25H29BN4O4 |
| Molecular Weight | 460.34 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | methyl 5-[(4-anilino-5-methylpyrimidin-2-yl)amino]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| SMILES | COC(=O)c1cc(Nc2ncc(C)c(Nc3ccccc3)n2)ccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C25H29BN4O4/c1-16-15-27-23(30-21(16)28-17-10-8-7-9-11-17)29-18-12-13-20(19(14-18)22(31)32-6)26-33-24(2,3)25(4,5)34-26/h7-15H,1-6H3,(H2,27,28,29,30) |
| InChIKey | GDNNOSJGSBVIIK-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.34 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|