C26H30BClN4O4 — CID 155572786
methyl 5-[[4-[(3-chlorophenyl)methylamino]-5-methylpyrimidin-2-yl]amino]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (PubChem CID 155572786) has the molecular formula C26H30BClN4O4 and a molecular weight of 508.82 g/mol. Its IUPAC name is methyl 5-[[4-[(3-chlorophenyl)methylamino]-5-methylpyrimidin-2-yl]amino]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate.
| Compound Name | methyl 5-[[4-[(3-chlorophenyl)methylamino]-5-methylpyrimidin-2-yl]amino]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
|---|---|
| PubChem CID | 155572786 |
| Molecular Formula | C26H30BClN4O4 |
| Molecular Weight | 508.82 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | methyl 5-[[4-[(3-chlorophenyl)methylamino]-5-methylpyrimidin-2-yl]amino]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| SMILES | COC(=O)c1cc(Nc2ncc(C)c(NCc3cccc(Cl)c3)n2)ccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C26H30BClN4O4/c1-16-14-30-24(32-22(16)29-15-17-8-7-9-18(28)12-17)31-19-10-11-21(20(13-19)23(33)34-6)27-35-25(2,3)26(4,5)36-27/h7-14H,15H2,1-6H3,(H2,29,30,31,32) |
| InChIKey | ITRKSVZIAHAOGZ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.82 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|