C35H60O6 — CID 155573636
ethane;(2Z)-2-(16-formyloxy-11-hydroxy-3-methoxy-4,8,10,14-tetramethyl-2,3,4,5,6,7,9,11,12,13,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-ylidene)-6-methylhept-5-enoic acid (PubChem CID 155573636) has the molecular formula C35H60O6 and a molecular weight of 576.86 g/mol. Its IUPAC name is ethane;(2Z)-2-(16-formyloxy-11-hydroxy-3-methoxy-4,8,10,14-tetramethyl-2,3,4,5,6,7,9,11,12,13,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-ylidene)-6-methylhept-5-enoic acid.
| Compound Name | ethane;(2Z)-2-(16-formyloxy-11-hydroxy-3-methoxy-4,8,10,14-tetramethyl-2,3,4,5,6,7,9,11,12,13,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-ylidene)-6-methylhept-5-enoic acid |
|---|---|
| PubChem CID | 155573636 |
| Molecular Formula | C35H60O6 |
| Molecular Weight | 576.86 g/mol |
| Exact Mass | 576.44 |
| IUPAC Name | ethane;(2Z)-2-(16-formyloxy-11-hydroxy-3-methoxy-4,8,10,14-tetramethyl-2,3,4,5,6,7,9,11,12,13,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-ylidene)-6-methylhept-5-enoic acid |
| SMILES | CC.CC.COC1CCC2(C)C(CCC3(C)C2C(O)CC2/C(=C(\CCC=C(C)C)C(=O)O)C(OC=O)CC23C)C1C |
| InChI | InChI=1S/C31H48O6.2C2H6/c1-18(2)9-8-10-20(28(34)35)26-22-15-23(33)27-29(4)13-12-24(36-7)19(3)21(29)11-14-30(27,5)31(22,6)16-25(26)37-17-32;2*1-2/h9,17,19,21-25,27,33H,8,10-16H2,1-7H3,(H,34,35);2*1-2H3/b26-20-;; |
| InChIKey | INNMAAWLWFKTGE-MOEVNGRJSA-N |
| XLogP | 7.98 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.86 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|