About ethyl 1-methoxypentan-3-yl carbonate
ethyl 1-methoxypentan-3-yl carbonate (PubChem CID 155575061) has the molecular formula C9H18O4
and a molecular weight of 190.24 g/mol. Its IUPAC name is ethyl 1-methoxypentan-3-yl carbonate.
Molecular Properties
| Compound Name | ethyl 1-methoxypentan-3-yl carbonate |
| PubChem CID | 155575061 |
| Molecular Formula | C9H18O4 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | ethyl 1-methoxypentan-3-yl carbonate |
| SMILES | CCOC(=O)OC(CC)CCOC |
| InChI | InChI=1S/C9H18O4/c1-4-8(6-7-11-3)13-9(10)12-5-2/h8H,4-7H2,1-3H3 |
| InChIKey | FIXPRNMHCUVJPS-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 1-methoxypentan-3-yl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-methoxypentan-3-yl carbonate?
The IUPAC name of ethyl 1-methoxypentan-3-yl carbonate (CID 155575061) is ethyl 1-methoxypentan-3-yl carbonate.
What is the SMILES notation for ethyl 1-methoxypentan-3-yl carbonate?
The canonical SMILES for ethyl 1-methoxypentan-3-yl carbonate is CCOC(=O)OC(CC)CCOC.
What is the InChIKey of ethyl 1-methoxypentan-3-yl carbonate?
The InChIKey is FIXPRNMHCUVJPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O4/c1-4-8(6-7-11-3)13-9(10)12-5-2/h8H,4-7H2,1-3H3.
What are the key properties of ethyl 1-methoxypentan-3-yl carbonate?
ethyl 1-methoxypentan-3-yl carbonate has a molecular weight of 190.24 g/mol, XLogP of 1.97, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-methoxypentan-3-yl carbonate is sourced from PubChem (CID 155575061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).