C26H22N6O2 — CID 155578945
N-[3-[4-amino-3-(4-benzoylphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]cyclobutyl]but-2-ynamide (PubChem CID 155578945) has the molecular formula C26H22N6O2 and a molecular weight of 450.50 g/mol. Its IUPAC name is N-[3-[4-amino-3-(4-benzoylphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]cyclobutyl]but-2-ynamide.
| Compound Name | N-[3-[4-amino-3-(4-benzoylphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]cyclobutyl]but-2-ynamide |
|---|---|
| PubChem CID | 155578945 |
| Molecular Formula | C26H22N6O2 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | N-[3-[4-amino-3-(4-benzoylphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]cyclobutyl]but-2-ynamide |
| SMILES | CC#CC(=O)NC1CC(n2nc(-c3ccc(C(=O)c4ccccc4)cc3)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C26H22N6O2/c1-2-6-21(33)30-19-13-20(14-19)32-26-22(25(27)28-15-29-26)23(31-32)16-9-11-18(12-10-16)24(34)17-7-4-3-5-8-17/h3-5,7-12,15,19-20H,13-14H2,1H3,(H,30,33)(H2,27,28,29) |
| InChIKey | IDZMLTOKJNNECX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 115.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|