C14H20N4O3 — CID 155579337
9-(1-methylpyrazole-4-carbonyl)-3,9-diazaspiro[5.5]undecane-2,4-dione;molecular hydrogen (PubChem CID 155579337) has the molecular formula C14H20N4O3 and a molecular weight of 292.34 g/mol. Its IUPAC name is 9-(1-methylpyrazole-4-carbonyl)-3,9-diazaspiro[5.5]undecane-2,4-dione;molecular hydrogen.
| Compound Name | 9-(1-methylpyrazole-4-carbonyl)-3,9-diazaspiro[5.5]undecane-2,4-dione;molecular hydrogen |
|---|---|
| PubChem CID | 155579337 |
| Molecular Formula | C14H20N4O3 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 9-(1-methylpyrazole-4-carbonyl)-3,9-diazaspiro[5.5]undecane-2,4-dione;molecular hydrogen |
| SMILES | Cn1cc(C(=O)N2CCC3(CC2)CC(=O)NC(=O)C3)cn1.[H][H] |
| InChI | InChI=1S/C14H18N4O3.H2/c1-17-9-10(8-15-17)13(21)18-4-2-14(3-5-18)6-11(19)16-12(20)7-14;/h8-9H,2-7H2,1H3,(H,16,19,20);1H |
| InChIKey | ITTPFTRHAHNGBT-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|