C16H19N3O3 — CID 155579356
9-(2-methylpyridine-4-carbonyl)-3,9-diazaspiro[5.5]undecane-2,4-dione (PubChem CID 155579356) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is 9-(2-methylpyridine-4-carbonyl)-3,9-diazaspiro[5.5]undecane-2,4-dione.
| Compound Name | 9-(2-methylpyridine-4-carbonyl)-3,9-diazaspiro[5.5]undecane-2,4-dione |
|---|---|
| PubChem CID | 155579356 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 9-(2-methylpyridine-4-carbonyl)-3,9-diazaspiro[5.5]undecane-2,4-dione |
| SMILES | Cc1cc(C(=O)N2CCC3(CC2)CC(=O)NC(=O)C3)ccn1 |
| InChI | InChI=1S/C16H19N3O3/c1-11-8-12(2-5-17-11)15(22)19-6-3-16(4-7-19)9-13(20)18-14(21)10-16/h2,5,8H,3-4,6-7,9-10H2,1H3,(H,18,20,21) |
| InChIKey | QFJXHIFLLLJJDK-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|