C30H26F4N6O4S — CID 155581518
(3Z)-1-[2-fluoro-4-[1-[4-(2,2,2-trifluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]-3-[3-(5-methoxy-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]urea (PubChem CID 155581518) has the molecular formula C30H26F4N6O4S and a molecular weight of 642.64 g/mol. Its IUPAC name is (3Z)-1-[2-fluoro-4-[1-[4-(2,2,2-trifluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]-3-[3-(5-methoxy-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]urea.
| Compound Name | (3Z)-1-[2-fluoro-4-[1-[4-(2,2,2-trifluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]-3-[3-(5-methoxy-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]urea |
|---|---|
| PubChem CID | 155581518 |
| Molecular Formula | C30H26F4N6O4S |
| Molecular Weight | 642.64 g/mol |
| Exact Mass | 642.17 |
| IUPAC Name | (3Z)-1-[2-fluoro-4-[1-[4-(2,2,2-trifluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]-3-[3-(5-methoxy-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]urea |
| SMILES | COc1ccc(C(C)C)c(N2C(=O)CS/C2=N\C(=O)Nc2ccc(-c3ncn(-c4ccc(OCC(F)(F)F)cc4)n3)cc2F)c1 |
| InChI | InChI=1S/C30H26F4N6O4S/c1-17(2)22-10-9-21(43-3)13-25(22)40-26(41)14-45-29(40)37-28(42)36-24-11-4-18(12-23(24)31)27-35-16-39(38-27)19-5-7-20(8-6-19)44-15-30(32,33)34/h4-13,16-17H,14-15H2,1-3H3,(H,36,42)/b37-29- |
| InChIKey | KNFPDRQKOXWBDF-GPFIVKHLSA-N |
| XLogP | 6.81 |
| TPSA | 110.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.64 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|