C11H12F3NO3S — CID 155585083
(Z)-3,4,4-trifluoro-4-(3-methoxyphenyl)sulfonylbut-2-en-1-amine (PubChem CID 155585083) has the molecular formula C11H12F3NO3S and a molecular weight of 295.28 g/mol. Its IUPAC name is (Z)-3,4,4-trifluoro-4-(3-methoxyphenyl)sulfonylbut-2-en-1-amine.
| Compound Name | (Z)-3,4,4-trifluoro-4-(3-methoxyphenyl)sulfonylbut-2-en-1-amine |
|---|---|
| PubChem CID | 155585083 |
| Molecular Formula | C11H12F3NO3S |
| Molecular Weight | 295.28 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | (Z)-3,4,4-trifluoro-4-(3-methoxyphenyl)sulfonylbut-2-en-1-amine |
| SMILES | COc1cccc(S(=O)(=O)C(F)(F)/C(F)=C/CN)c1 |
| InChI | InChI=1S/C11H12F3NO3S/c1-18-8-3-2-4-9(7-8)19(16,17)11(13,14)10(12)5-6-15/h2-5,7H,6,15H2,1H3/b10-5- |
| InChIKey | FQTZPARUJIAWAP-YHYXMXQVSA-N |
| XLogP | 1.87 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.28 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |