C28H32BN3O6W — CID 155589498
1-cyclohexyl-3-[[4-[2-(7-methoxy-4,4-dimethyl-1,3-dioxoisoquinolin-2-yl)ethyl]benzene-6-id-1-yl]-(oxomethoxy)boranyl]urea;tungsten(2+) (PubChem CID 155589498) has the molecular formula C28H32BN3O6W and a molecular weight of 701.23 g/mol. Its IUPAC name is 1-cyclohexyl-3-[[4-[2-(7-methoxy-4,4-dimethyl-1,3-dioxoisoquinolin-2-yl)ethyl]benzene-6-id-1-yl]-(oxomethoxy)boranyl]urea;tungsten(2+).
| Compound Name | 1-cyclohexyl-3-[[4-[2-(7-methoxy-4,4-dimethyl-1,3-dioxoisoquinolin-2-yl)ethyl]benzene-6-id-1-yl]-(oxomethoxy)boranyl]urea;tungsten(2+) |
|---|---|
| PubChem CID | 155589498 |
| Molecular Formula | C28H32BN3O6W |
| Molecular Weight | 701.23 g/mol |
| Exact Mass | 701.19 |
| IUPAC Name | 1-cyclohexyl-3-[[4-[2-(7-methoxy-4,4-dimethyl-1,3-dioxoisoquinolin-2-yl)ethyl]benzene-6-id-1-yl]-(oxomethoxy)boranyl]urea;tungsten(2+) |
| SMILES | COc1ccc2c(c1)C(=O)N(CCc1c[c-]c(B(NC(=O)NC3CCCCC3)O[C-]=O)cc1)C(=O)C2(C)C.[W+2] |
| InChI | InChI=1S/C28H32BN3O6.W/c1-28(2)24-14-13-22(37-3)17-23(24)25(34)32(26(28)35)16-15-19-9-11-20(12-10-19)29(38-18-33)31-27(36)30-21-7-5-4-6-8-21;/h9-11,13-14,17,21H,4-8,15-16H2,1-3H3,(H2,30,31,36);/q-2;+2 |
| InChIKey | PEBJYJDTRKDGML-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.23 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|