C22H26N2O5S — CID 171977490
4-[2-(7-methoxy-4,4-dimethyl-1,3-dioxoisoquinolin-2-yl)ethyl]-N,N-dimethylbenzenesulfonamide (PubChem CID 171977490) has the molecular formula C22H26N2O5S and a molecular weight of 430.53 g/mol. Its IUPAC name is 4-[2-(7-methoxy-4,4-dimethyl-1,3-dioxoisoquinolin-2-yl)ethyl]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-[2-(7-methoxy-4,4-dimethyl-1,3-dioxoisoquinolin-2-yl)ethyl]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 171977490 |
| Molecular Formula | C22H26N2O5S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 4-[2-(7-methoxy-4,4-dimethyl-1,3-dioxoisoquinolin-2-yl)ethyl]-N,N-dimethylbenzenesulfonamide |
| SMILES | COc1ccc2c(c1)C(=O)N(CCc1ccc(S(=O)(=O)N(C)C)cc1)C(=O)C2(C)C |
| InChI | InChI=1S/C22H26N2O5S/c1-22(2)19-11-8-16(29-5)14-18(19)20(25)24(21(22)26)13-12-15-6-9-17(10-7-15)30(27,28)23(3)4/h6-11,14H,12-13H2,1-5H3 |
| InChIKey | PKKUCFBTTBVYJU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|