C24H30N2O4 — CID 14350346
2-[3-[2-(3,4-dimethoxyphenyl)ethylamino]propyl]-4,4-dimethylisoquinoline-1,3-dione (PubChem CID 14350346) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is 2-[3-[2-(3,4-dimethoxyphenyl)ethylamino]propyl]-4,4-dimethylisoquinoline-1,3-dione.
| Compound Name | 2-[3-[2-(3,4-dimethoxyphenyl)ethylamino]propyl]-4,4-dimethylisoquinoline-1,3-dione |
|---|---|
| PubChem CID | 14350346 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 2-[3-[2-(3,4-dimethoxyphenyl)ethylamino]propyl]-4,4-dimethylisoquinoline-1,3-dione |
| SMILES | COc1ccc(CCNCCCN2C(=O)c3ccccc3C(C)(C)C2=O)cc1OC |
| InChI | InChI=1S/C24H30N2O4/c1-24(2)19-9-6-5-8-18(19)22(27)26(23(24)28)15-7-13-25-14-12-17-10-11-20(29-3)21(16-17)30-4/h5-6,8-11,16,25H,7,12-15H2,1-4H3 |
| InChIKey | CKPSXDXTLVGQPN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|