C25H32N4O6 — CID 69146381
3-(7,8-diamino-4,4-dimethyl-1,3-dioxoisoquinolin-2-yl)propyl-[2-(3,4-dimethoxyphenyl)ethyl]carbamic acid (PubChem CID 69146381) has the molecular formula C25H32N4O6 and a molecular weight of 484.55 g/mol. Its IUPAC name is 3-(7,8-diamino-4,4-dimethyl-1,3-dioxoisoquinolin-2-yl)propyl-[2-(3,4-dimethoxyphenyl)ethyl]carbamic acid.
| Compound Name | 3-(7,8-diamino-4,4-dimethyl-1,3-dioxoisoquinolin-2-yl)propyl-[2-(3,4-dimethoxyphenyl)ethyl]carbamic acid |
|---|---|
| PubChem CID | 69146381 |
| Molecular Formula | C25H32N4O6 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | 3-(7,8-diamino-4,4-dimethyl-1,3-dioxoisoquinolin-2-yl)propyl-[2-(3,4-dimethoxyphenyl)ethyl]carbamic acid |
| SMILES | COc1ccc(CCN(CCCN2C(=O)c3c(ccc(N)c3N)C(C)(C)C2=O)C(=O)O)cc1OC |
| InChI | InChI=1S/C25H32N4O6/c1-25(2)16-7-8-17(26)21(27)20(16)22(30)29(23(25)31)12-5-11-28(24(32)33)13-10-15-6-9-18(34-3)19(14-15)35-4/h6-9,14H,5,10-13,26-27H2,1-4H3,(H,32,33) |
| InChIKey | KQKUDAVFZLHUSN-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 148.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|