C31H32ClFN4O4 — CID 11387634
2-(4-chloro-3-fluorophenyl)-8-[3-[2-(3,4-dimethoxyphenyl)ethylamino]propyl]-6,6-dimethyl-3H-imidazo[4,5-h]isoquinoline-7,9-dione (PubChem CID 11387634) has the molecular formula C31H32ClFN4O4 and a molecular weight of 579.07 g/mol. Its IUPAC name is 2-(4-chloro-3-fluorophenyl)-8-[3-[2-(3,4-dimethoxyphenyl)ethylamino]propyl]-6,6-dimethyl-3H-imidazo[4,5-h]isoquinoline-7,9-dione.
| Compound Name | 2-(4-chloro-3-fluorophenyl)-8-[3-[2-(3,4-dimethoxyphenyl)ethylamino]propyl]-6,6-dimethyl-3H-imidazo[4,5-h]isoquinoline-7,9-dione |
|---|---|
| PubChem CID | 11387634 |
| Molecular Formula | C31H32ClFN4O4 |
| Molecular Weight | 579.07 g/mol |
| Exact Mass | 578.21 |
| IUPAC Name | 2-(4-chloro-3-fluorophenyl)-8-[3-[2-(3,4-dimethoxyphenyl)ethylamino]propyl]-6,6-dimethyl-3H-imidazo[4,5-h]isoquinoline-7,9-dione |
| SMILES | COc1ccc(CCNCCCN2C(=O)c3c(ccc4[nH]c(-c5ccc(Cl)c(F)c5)nc34)C(C)(C)C2=O)cc1OC |
| InChI | InChI=1S/C31H32ClFN4O4/c1-31(2)20-8-10-23-27(36-28(35-23)19-7-9-21(32)22(33)17-19)26(20)29(38)37(30(31)39)15-5-13-34-14-12-18-6-11-24(40-3)25(16-18)41-4/h6-11,16-17,34H,5,12-15H2,1-4H3,(H,35,36) |
| InChIKey | PGHOATDIJCXGLT-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 96.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.07 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|