C26H34N2O6 — CID 21438357
7-methoxy-4,4-dimethyl-2-[3-[2-(3,4,5-trimethoxyphenyl)ethylamino]propyl]isoquinoline-1,3-dione (PubChem CID 21438357) has the molecular formula C26H34N2O6 and a molecular weight of 470.57 g/mol. Its IUPAC name is 7-methoxy-4,4-dimethyl-2-[3-[2-(3,4,5-trimethoxyphenyl)ethylamino]propyl]isoquinoline-1,3-dione.
| Compound Name | 7-methoxy-4,4-dimethyl-2-[3-[2-(3,4,5-trimethoxyphenyl)ethylamino]propyl]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 21438357 |
| Molecular Formula | C26H34N2O6 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | 7-methoxy-4,4-dimethyl-2-[3-[2-(3,4,5-trimethoxyphenyl)ethylamino]propyl]isoquinoline-1,3-dione |
| SMILES | COc1ccc2c(c1)C(=O)N(CCCNCCc1cc(OC)c(OC)c(OC)c1)C(=O)C2(C)C |
| InChI | InChI=1S/C26H34N2O6/c1-26(2)20-9-8-18(31-3)16-19(20)24(29)28(25(26)30)13-7-11-27-12-10-17-14-21(32-4)23(34-6)22(15-17)33-5/h8-9,14-16,27H,7,10-13H2,1-6H3 |
| InChIKey | XBQZQMASFDFJGG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|