C32H35N5O7 — CID 11261931
8-[3-[2-(3,4-dimethoxyphenyl)ethylamino]propyl]-4-hydroxy-6,6-dimethyl-2-(4-methyl-3-nitrophenyl)-3H-imidazo[4,5-h]isoquinoline-7,9-dione (PubChem CID 11261931) has the molecular formula C32H35N5O7 and a molecular weight of 601.66 g/mol. Its IUPAC name is 8-[3-[2-(3,4-dimethoxyphenyl)ethylamino]propyl]-4-hydroxy-6,6-dimethyl-2-(4-methyl-3-nitrophenyl)-3H-imidazo[4,5-h]isoquinoline-7,9-dione.
| Compound Name | 8-[3-[2-(3,4-dimethoxyphenyl)ethylamino]propyl]-4-hydroxy-6,6-dimethyl-2-(4-methyl-3-nitrophenyl)-3H-imidazo[4,5-h]isoquinoline-7,9-dione |
|---|---|
| PubChem CID | 11261931 |
| Molecular Formula | C32H35N5O7 |
| Molecular Weight | 601.66 g/mol |
| Exact Mass | 601.25 |
| IUPAC Name | 8-[3-[2-(3,4-dimethoxyphenyl)ethylamino]propyl]-4-hydroxy-6,6-dimethyl-2-(4-methyl-3-nitrophenyl)-3H-imidazo[4,5-h]isoquinoline-7,9-dione |
| SMILES | COc1ccc(CCNCCCN2C(=O)c3c(cc(O)c4[nH]c(-c5ccc(C)c([N+](=O)[O-])c5)nc34)C(C)(C)C2=O)cc1OC |
| InChI | InChI=1S/C32H35N5O7/c1-18-7-9-20(16-22(18)37(41)42)29-34-27-23(38)17-21-26(28(27)35-29)30(39)36(31(40)32(21,2)3)14-6-12-33-13-11-19-8-10-24(43-4)25(15-19)44-5/h7-10,15-17,33,38H,6,11-14H2,1-5H3,(H,34,35) |
| InChIKey | XPPWACTXJBBSDL-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 159.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.66 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|