C37H42BrN5O8 — CID 69452339
3-[4-bromo-6,6-dimethyl-2-(4-methyl-3-nitrophenyl)-7,9-dioxo-1H-imidazo[4,5-h]isoquinolin-8-yl]propyl-[2-(3,4-dimethoxyphenyl)-3,3-dimethylbutyl]carbamic acid (PubChem CID 69452339) has the molecular formula C37H42BrN5O8 and a molecular weight of 764.67 g/mol. Its IUPAC name is 3-[4-bromo-6,6-dimethyl-2-(4-methyl-3-nitrophenyl)-7,9-dioxo-1H-imidazo[4,5-h]isoquinolin-8-yl]propyl-[2-(3,4-dimethoxyphenyl)-3,3-dimethylbutyl]carbamic acid.
| Compound Name | 3-[4-bromo-6,6-dimethyl-2-(4-methyl-3-nitrophenyl)-7,9-dioxo-1H-imidazo[4,5-h]isoquinolin-8-yl]propyl-[2-(3,4-dimethoxyphenyl)-3,3-dimethylbutyl]carbamic acid |
|---|---|
| PubChem CID | 69452339 |
| Molecular Formula | C37H42BrN5O8 |
| Molecular Weight | 764.67 g/mol |
| Exact Mass | 763.22 |
| IUPAC Name | 3-[4-bromo-6,6-dimethyl-2-(4-methyl-3-nitrophenyl)-7,9-dioxo-1H-imidazo[4,5-h]isoquinolin-8-yl]propyl-[2-(3,4-dimethoxyphenyl)-3,3-dimethylbutyl]carbamic acid |
| SMILES | COc1ccc(C(CN(CCCN2C(=O)c3c(cc(Br)c4nc(-c5ccc(C)c([N+](=O)[O-])c5)[nH]c34)C(C)(C)C2=O)C(=O)O)C(C)(C)C)cc1OC |
| InChI | InChI=1S/C37H42BrN5O8/c1-20-10-11-22(16-26(20)43(48)49)32-39-30-25(38)18-23-29(31(30)40-32)33(44)42(34(45)37(23,5)6)15-9-14-41(35(46)47)19-24(36(2,3)4)21-12-13-27(50-7)28(17-21)51-8/h10-13,16-18,24H,9,14-15,19H2,1-8H3,(H,39,40)(H,46,47) |
| InChIKey | OOXDNLULVFIKMN-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 168.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.67 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|