C21H25N5O2S — CID 155589656
(2S)-2-(methylamino)-N-[2-[[2-methyl-6-[(5-phenyl-1,3-thiazol-2-yl)amino]-4-pyridinyl]oxy]ethyl]propanamide (PubChem CID 155589656) has the molecular formula C21H25N5O2S and a molecular weight of 411.53 g/mol. Its IUPAC name is (2S)-2-(methylamino)-N-[2-[[2-methyl-6-[(5-phenyl-1,3-thiazol-2-yl)amino]-4-pyridinyl]oxy]ethyl]propanamide.
| Compound Name | (2S)-2-(methylamino)-N-[2-[[2-methyl-6-[(5-phenyl-1,3-thiazol-2-yl)amino]-4-pyridinyl]oxy]ethyl]propanamide |
|---|---|
| PubChem CID | 155589656 |
| Molecular Formula | C21H25N5O2S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | (2S)-2-(methylamino)-N-[2-[[2-methyl-6-[(5-phenyl-1,3-thiazol-2-yl)amino]-4-pyridinyl]oxy]ethyl]propanamide |
| SMILES | CN[C@@H](C)C(=O)NCCOc1cc(C)nc(Nc2ncc(-c3ccccc3)s2)c1 |
| InChI | InChI=1S/C21H25N5O2S/c1-14-11-17(28-10-9-23-20(27)15(2)22-3)12-19(25-14)26-21-24-13-18(29-21)16-7-5-4-6-8-16/h4-8,11-13,15,22H,9-10H2,1-3H3,(H,23,27)(H,24,25,26)/t15-/m0/s1 |
| InChIKey | AJLPFWZFRURMEX-HNNXBMFYSA-N |
| XLogP | 3.36 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|