C27H35N5O3 — CID 44527798
(2S)-4-methyl-2-[[6-methyl-2-(2-phenoxyethylamino)pyrimidin-4-yl]amino]-N-(2-phenoxyethyl)pentanamide (PubChem CID 44527798) has the molecular formula C27H35N5O3 and a molecular weight of 477.61 g/mol. Its IUPAC name is (2S)-4-methyl-2-[[6-methyl-2-(2-phenoxyethylamino)pyrimidin-4-yl]amino]-N-(2-phenoxyethyl)pentanamide.
| Compound Name | (2S)-4-methyl-2-[[6-methyl-2-(2-phenoxyethylamino)pyrimidin-4-yl]amino]-N-(2-phenoxyethyl)pentanamide |
|---|---|
| PubChem CID | 44527798 |
| Molecular Formula | C27H35N5O3 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.27 |
| IUPAC Name | (2S)-4-methyl-2-[[6-methyl-2-(2-phenoxyethylamino)pyrimidin-4-yl]amino]-N-(2-phenoxyethyl)pentanamide |
| SMILES | Cc1cc(N[C@@H](CC(C)C)C(=O)NCCOc2ccccc2)nc(NCCOc2ccccc2)n1 |
| InChI | InChI=1S/C27H35N5O3/c1-20(2)18-24(26(33)28-14-16-34-22-10-6-4-7-11-22)31-25-19-21(3)30-27(32-25)29-15-17-35-23-12-8-5-9-13-23/h4-13,19-20,24H,14-18H2,1-3H3,(H,28,33)(H2,29,30,31,32)/t24-/m0/s1 |
| InChIKey | XEZZHYVOBKIFAP-DEOSSOPVSA-N |
| XLogP | 4.30 |
| TPSA | 97.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|