C27H35N5O2 — CID 44528041
(2S)-4-methyl-2-[[6-methyl-2-[(3-methylphenyl)methylamino]pyrimidin-4-yl]amino]-N-(2-phenoxyethyl)pentanamide (PubChem CID 44528041) has the molecular formula C27H35N5O2 and a molecular weight of 461.61 g/mol. Its IUPAC name is (2S)-4-methyl-2-[[6-methyl-2-[(3-methylphenyl)methylamino]pyrimidin-4-yl]amino]-N-(2-phenoxyethyl)pentanamide.
| Compound Name | (2S)-4-methyl-2-[[6-methyl-2-[(3-methylphenyl)methylamino]pyrimidin-4-yl]amino]-N-(2-phenoxyethyl)pentanamide |
|---|---|
| PubChem CID | 44528041 |
| Molecular Formula | C27H35N5O2 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.28 |
| IUPAC Name | (2S)-4-methyl-2-[[6-methyl-2-[(3-methylphenyl)methylamino]pyrimidin-4-yl]amino]-N-(2-phenoxyethyl)pentanamide |
| SMILES | Cc1cccc(CNc2nc(C)cc(N[C@@H](CC(C)C)C(=O)NCCOc3ccccc3)n2)c1 |
| InChI | InChI=1S/C27H35N5O2/c1-19(2)15-24(26(33)28-13-14-34-23-11-6-5-7-12-23)31-25-17-21(4)30-27(32-25)29-18-22-10-8-9-20(3)16-22/h5-12,16-17,19,24H,13-15,18H2,1-4H3,(H,28,33)(H2,29,30,31,32)/t24-/m0/s1 |
| InChIKey | OEXOFGSURVSDBE-DEOSSOPVSA-N |
| XLogP | 4.73 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|