About 3-methylmorpholine;2-propan-2-ylpyrrolidin-1-ide;rhenium
3-methylmorpholine;2-propan-2-ylpyrrolidin-1-ide;rhenium (PubChem CID 155589776) has the molecular formula C12H25N2ORe-
and a molecular weight of 399.55 g/mol. Its IUPAC name is 3-methylmorpholine;2-propan-2-ylpyrrolidin-1-ide;rhenium.
Molecular Properties
| Compound Name | 3-methylmorpholine;2-propan-2-ylpyrrolidin-1-ide;rhenium |
| PubChem CID | 155589776 |
| Molecular Formula | C12H25N2ORe- |
| Molecular Weight | 399.55 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 3-methylmorpholine;2-propan-2-ylpyrrolidin-1-ide;rhenium |
| SMILES | CC(C)C1CCC[N-]1.CC1COCCN1.[Re] |
| InChI | InChI=1S/C7H14N.C5H11NO.Re/c1-6(2)7-4-3-5-8-7;1-5-4-7-3-2-6-5;/h6-7H,3-5H2,1-2H3;5-6H,2-4H2,1H3;/q-1;; |
| InChIKey | ZQFAMXRKJOWKAK-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 35.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.55 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methylmorpholine;2-propan-2-ylpyrrolidin-1-ide;rhenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylmorpholine;2-propan-2-ylpyrrolidin-1-ide;rhenium?
The IUPAC name of 3-methylmorpholine;2-propan-2-ylpyrrolidin-1-ide;rhenium (CID 155589776) is 3-methylmorpholine;2-propan-2-ylpyrrolidin-1-ide;rhenium.
What is the SMILES notation for 3-methylmorpholine;2-propan-2-ylpyrrolidin-1-ide;rhenium?
The canonical SMILES for 3-methylmorpholine;2-propan-2-ylpyrrolidin-1-ide;rhenium is CC(C)C1CCC[N-]1.CC1COCCN1.[Re].
What is the InChIKey of 3-methylmorpholine;2-propan-2-ylpyrrolidin-1-ide;rhenium?
The InChIKey is ZQFAMXRKJOWKAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N.C5H11NO.Re/c1-6(2)7-4-3-5-8-7;1-5-4-7-3-2-6-5;/h6-7H,3-5H2,1-2H3;5-6H,2-4H2,1H3;/q-1;;.
What are the key properties of 3-methylmorpholine;2-propan-2-ylpyrrolidin-1-ide;rhenium?
3-methylmorpholine;2-propan-2-ylpyrrolidin-1-ide;rhenium has a molecular weight of 399.55 g/mol, XLogP of 2.17, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylmorpholine;2-propan-2-ylpyrrolidin-1-ide;rhenium is sourced from PubChem (CID 155589776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).