C10H15N3 — CID 155591008
2,7-dimethyl-1,3-dihydropyrrolo[3,4-c]azepin-7-amine (PubChem CID 155591008) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is 2,7-dimethyl-1,3-dihydropyrrolo[3,4-c]azepin-7-amine.
| Compound Name | 2,7-dimethyl-1,3-dihydropyrrolo[3,4-c]azepin-7-amine |
|---|---|
| PubChem CID | 155591008 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 2,7-dimethyl-1,3-dihydropyrrolo[3,4-c]azepin-7-amine |
| SMILES | CN1CC2=CN=CC(C)(N)C=C2C1 |
| InChI | InChI=1S/C10H15N3/c1-10(11)3-8-5-13(2)6-9(8)4-12-7-10/h3-4,7H,5-6,11H2,1-2H3 |
| InChIKey | WHYQCDRJSAGPTN-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |