C16H20Br3NO2 — CID 155591614
methyl 7-bromo-3-(2-bromoethyl)-2-(bromomethyl)-1-propan-2-yl-2,3-dihydroindole-5-carboxylate (PubChem CID 155591614) has the molecular formula C16H20Br3NO2 and a molecular weight of 498.05 g/mol. Its IUPAC name is methyl 7-bromo-3-(2-bromoethyl)-2-(bromomethyl)-1-propan-2-yl-2,3-dihydroindole-5-carboxylate.
| Compound Name | methyl 7-bromo-3-(2-bromoethyl)-2-(bromomethyl)-1-propan-2-yl-2,3-dihydroindole-5-carboxylate |
|---|---|
| PubChem CID | 155591614 |
| Molecular Formula | C16H20Br3NO2 |
| Molecular Weight | 498.05 g/mol |
| Exact Mass | 494.90 |
| IUPAC Name | methyl 7-bromo-3-(2-bromoethyl)-2-(bromomethyl)-1-propan-2-yl-2,3-dihydroindole-5-carboxylate |
| SMILES | COC(=O)c1cc(Br)c2c(c1)C(CCBr)C(CBr)N2C(C)C |
| InChI | InChI=1S/C16H20Br3NO2/c1-9(2)20-14(8-18)11(4-5-17)12-6-10(16(21)22-3)7-13(19)15(12)20/h6-7,9,11,14H,4-5,8H2,1-3H3 |
| InChIKey | HPNQAVUEGVIYHN-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.05 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|