C17H19FN2O4S — CID 155592308
ethyl 2-acetamido-5-[3-(2-fluorophenoxy)propyl]-1,3-thiazole-4-carboxylate (PubChem CID 155592308) has the molecular formula C17H19FN2O4S and a molecular weight of 366.41 g/mol. Its IUPAC name is ethyl 2-acetamido-5-[3-(2-fluorophenoxy)propyl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-acetamido-5-[3-(2-fluorophenoxy)propyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 155592308 |
| Molecular Formula | C17H19FN2O4S |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | ethyl 2-acetamido-5-[3-(2-fluorophenoxy)propyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc(NC(C)=O)sc1CCCOc1ccccc1F |
| InChI | InChI=1S/C17H19FN2O4S/c1-3-23-16(22)15-14(25-17(20-15)19-11(2)21)9-6-10-24-13-8-5-4-7-12(13)18/h4-5,7-8H,3,6,9-10H2,1-2H3,(H,19,20,21) |
| InChIKey | PFROCFUDTOYRSZ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|