C19H20F3N3O4S — CID 4521586
methyl 3,3,3-trifluoro-2-[(2-phenoxyacetyl)amino]-2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylamino)propanoate (PubChem CID 4521586) has the molecular formula C19H20F3N3O4S and a molecular weight of 443.45 g/mol. Its IUPAC name is methyl 3,3,3-trifluoro-2-[(2-phenoxyacetyl)amino]-2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylamino)propanoate.
| Compound Name | methyl 3,3,3-trifluoro-2-[(2-phenoxyacetyl)amino]-2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylamino)propanoate |
|---|---|
| PubChem CID | 4521586 |
| Molecular Formula | C19H20F3N3O4S |
| Molecular Weight | 443.45 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | methyl 3,3,3-trifluoro-2-[(2-phenoxyacetyl)amino]-2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylamino)propanoate |
| SMILES | COC(=O)C(NC(=O)COc1ccccc1)(Nc1nc2c(s1)CCCC2)C(F)(F)F |
| InChI | InChI=1S/C19H20F3N3O4S/c1-28-16(27)18(19(20,21)22,24-15(26)11-29-12-7-3-2-4-8-12)25-17-23-13-9-5-6-10-14(13)30-17/h2-4,7-8H,5-6,9-11H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | QDNRIWGFNCTNRZ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.45 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|