C30H28FN3O2S — CID 155599118
1-fluoro-3-methoxysulfanylbenzene;(2-naphthalen-1-yl-3H-benzimidazol-5-yl)-piperidin-1-ylmethanone (PubChem CID 155599118) has the molecular formula C30H28FN3O2S and a molecular weight of 513.64 g/mol. Its IUPAC name is 1-fluoro-3-methoxysulfanylbenzene;(2-naphthalen-1-yl-3H-benzimidazol-5-yl)-piperidin-1-ylmethanone.
| Compound Name | 1-fluoro-3-methoxysulfanylbenzene;(2-naphthalen-1-yl-3H-benzimidazol-5-yl)-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 155599118 |
| Molecular Formula | C30H28FN3O2S |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.19 |
| IUPAC Name | 1-fluoro-3-methoxysulfanylbenzene;(2-naphthalen-1-yl-3H-benzimidazol-5-yl)-piperidin-1-ylmethanone |
| SMILES | COSc1cccc(F)c1.O=C(c1ccc2nc(-c3cccc4ccccc34)[nH]c2c1)N1CCCCC1 |
| InChI | InChI=1S/C23H21N3O.C7H7FOS/c27-23(26-13-4-1-5-14-26)17-11-12-20-21(15-17)25-22(24-20)19-10-6-8-16-7-2-3-9-18(16)19;1-9-10-7-4-2-3-6(8)5-7/h2-3,6-12,15H,1,4-5,13-14H2,(H,24,25);2-5H,1H3 |
| InChIKey | PKWXCSSREHCIGX-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|