C30H29FN4O2S — CID 155599087
1-fluoro-3-methoxysulfanylbenzene;(4-methylpiperazin-1-yl)-(2-naphthalen-1-yl-3H-benzimidazol-5-yl)methanone (PubChem CID 155599087) has the molecular formula C30H29FN4O2S and a molecular weight of 528.65 g/mol. Its IUPAC name is 1-fluoro-3-methoxysulfanylbenzene;(4-methylpiperazin-1-yl)-(2-naphthalen-1-yl-3H-benzimidazol-5-yl)methanone.
| Compound Name | 1-fluoro-3-methoxysulfanylbenzene;(4-methylpiperazin-1-yl)-(2-naphthalen-1-yl-3H-benzimidazol-5-yl)methanone |
|---|---|
| PubChem CID | 155599087 |
| Molecular Formula | C30H29FN4O2S |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.20 |
| IUPAC Name | 1-fluoro-3-methoxysulfanylbenzene;(4-methylpiperazin-1-yl)-(2-naphthalen-1-yl-3H-benzimidazol-5-yl)methanone |
| SMILES | CN1CCN(C(=O)c2ccc3nc(-c4cccc5ccccc45)[nH]c3c2)CC1.COSc1cccc(F)c1 |
| InChI | InChI=1S/C23H22N4O.C7H7FOS/c1-26-11-13-27(14-12-26)23(28)17-9-10-20-21(15-17)25-22(24-20)19-8-4-6-16-5-2-3-7-18(16)19;1-9-10-7-4-2-3-6(8)5-7/h2-10,15H,11-14H2,1H3,(H,24,25);2-5H,1H3 |
| InChIKey | OOCBMQQLOPOAPC-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|