C41H24N4O — CID 155601196
9-(3-carbazol-9-ylphenyl)-4-(4-isocyanophenyl)-2-phenyl-[1]benzofuro[3,2-d]pyrimidine (PubChem CID 155601196) has the molecular formula C41H24N4O and a molecular weight of 588.67 g/mol. Its IUPAC name is 9-(3-carbazol-9-ylphenyl)-4-(4-isocyanophenyl)-2-phenyl-[1]benzofuro[3,2-d]pyrimidine.
| Compound Name | 9-(3-carbazol-9-ylphenyl)-4-(4-isocyanophenyl)-2-phenyl-[1]benzofuro[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 155601196 |
| Molecular Formula | C41H24N4O |
| Molecular Weight | 588.67 g/mol |
| Exact Mass | 588.20 |
| IUPAC Name | 9-(3-carbazol-9-ylphenyl)-4-(4-isocyanophenyl)-2-phenyl-[1]benzofuro[3,2-d]pyrimidine |
| SMILES | [C-]#[N+]c1ccc(-c2nc(-c3ccccc3)nc3c2oc2cccc(-c4cccc(-n5c6ccccc6c6ccccc65)c4)c23)cc1 |
| InChI | InChI=1S/C41H24N4O/c1-42-29-23-21-26(22-24-29)38-40-39(44-41(43-38)27-11-3-2-4-12-27)37-31(17-10-20-36(37)46-40)28-13-9-14-30(25-28)45-34-18-7-5-15-32(34)33-16-6-8-19-35(33)45/h2-25H |
| InChIKey | IYMQZKAVHYMXFR-UHFFFAOYSA-N |
| XLogP | 11.02 |
| TPSA | 48.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.67 |
| LogP ≤ 5 | 11.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|