About CID 155601419
CID 155601419 (PubChem CID 155601419) has the molecular formula C8H8IOSi
and a molecular weight of 275.14 g/mol.
Molecular Properties
| Compound Name | CID 155601419 |
| PubChem CID | 155601419 |
| Molecular Formula | C8H8IOSi |
| Molecular Weight | 275.14 g/mol |
| Exact Mass | 274.94 |
| IUPAC Name | — |
| SMILES | Oc1cccc(I)c1CC[Si] |
| InChI | InChI=1S/C8H8IOSi/c9-7-2-1-3-8(10)6(7)4-5-11/h1-3,10H,4-5H2 |
| InChIKey | WELJMZPAGVFOKF-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.14 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze CID 155601419 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155601419?
The IUPAC name of CID 155601419 (CID 155601419) is not available.
What is the SMILES notation for CID 155601419?
The canonical SMILES for CID 155601419 is Oc1cccc(I)c1CC[Si].
What is the InChIKey of CID 155601419?
The InChIKey is WELJMZPAGVFOKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8IOSi/c9-7-2-1-3-8(10)6(7)4-5-11/h1-3,10H,4-5H2.
What are the key properties of CID 155601419?
CID 155601419 has a molecular weight of 275.14 g/mol, XLogP of 2.13, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155601419 is sourced from PubChem (CID 155601419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).