C21H14N4O — CID 155603381
2-dibenzofuran-4-yl-4-methyl-6-pyridin-4-yl-1,3,5-triazine (PubChem CID 155603381) has the molecular formula C21H14N4O and a molecular weight of 338.37 g/mol. Its IUPAC name is 2-dibenzofuran-4-yl-4-methyl-6-pyridin-4-yl-1,3,5-triazine.
| Compound Name | 2-dibenzofuran-4-yl-4-methyl-6-pyridin-4-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 155603381 |
| Molecular Formula | C21H14N4O |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 2-dibenzofuran-4-yl-4-methyl-6-pyridin-4-yl-1,3,5-triazine |
| SMILES | Cc1nc(-c2ccncc2)nc(-c2cccc3c2oc2ccccc23)n1 |
| InChI | InChI=1S/C21H14N4O/c1-13-23-20(14-9-11-22-12-10-14)25-21(24-13)17-7-4-6-16-15-5-2-3-8-18(15)26-19(16)17/h2-12H,1H3 |
| InChIKey | ODBFWSDHIQVAGW-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |