About 10-isocyanononadeca-1,18-diene
10-isocyanononadeca-1,18-diene (PubChem CID 155605584) has the molecular formula C20H35N
and a molecular weight of 289.51 g/mol. Its IUPAC name is 10-isocyanononadeca-1,18-diene.
Molecular Properties
| Compound Name | 10-isocyanononadeca-1,18-diene |
| PubChem CID | 155605584 |
| Molecular Formula | C20H35N |
| Molecular Weight | 289.51 g/mol |
| Exact Mass | 289.28 |
| IUPAC Name | 10-isocyanononadeca-1,18-diene |
| SMILES | [C-]#[N+]C(CCCCCCCC=C)CCCCCCCC=C |
| InChI | InChI=1S/C20H35N/c1-4-6-8-10-12-14-16-18-20(21-3)19-17-15-13-11-9-7-5-2/h4-5,20H,1-2,6-19H2 |
| InChIKey | UHKOFJQJDKVVDN-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 289.51 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 10-isocyanononadeca-1,18-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-isocyanononadeca-1,18-diene?
The IUPAC name of 10-isocyanononadeca-1,18-diene (CID 155605584) is 10-isocyanononadeca-1,18-diene.
What is the SMILES notation for 10-isocyanononadeca-1,18-diene?
The canonical SMILES for 10-isocyanononadeca-1,18-diene is [C-]#[N+]C(CCCCCCCC=C)CCCCCCCC=C.
What is the InChIKey of 10-isocyanononadeca-1,18-diene?
The InChIKey is UHKOFJQJDKVVDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H35N/c1-4-6-8-10-12-14-16-18-20(21-3)19-17-15-13-11-9-7-5-2/h4-5,20H,1-2,6-19H2.
What are the key properties of 10-isocyanononadeca-1,18-diene?
10-isocyanononadeca-1,18-diene has a molecular weight of 289.51 g/mol, XLogP of 7.11, 16 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 10-isocyanononadeca-1,18-diene is sourced from PubChem (CID 155605584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).