C20H46N4O5 — CID 155605637
2-[2-(2-aminoethoxymethyl)-2-[2,2-bis(2-aminoethoxymethyl)butoxymethyl]butoxy]ethanamine (PubChem CID 155605637) has the molecular formula C20H46N4O5 and a molecular weight of 422.61 g/mol. Its IUPAC name is 2-[2-(2-aminoethoxymethyl)-2-[2,2-bis(2-aminoethoxymethyl)butoxymethyl]butoxy]ethanamine.
| Compound Name | 2-[2-(2-aminoethoxymethyl)-2-[2,2-bis(2-aminoethoxymethyl)butoxymethyl]butoxy]ethanamine |
|---|---|
| PubChem CID | 155605637 |
| Molecular Formula | C20H46N4O5 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.35 |
| IUPAC Name | 2-[2-(2-aminoethoxymethyl)-2-[2,2-bis(2-aminoethoxymethyl)butoxymethyl]butoxy]ethanamine |
| SMILES | CCC(COCCN)(COCCN)COCC(CC)(COCCN)COCCN |
| InChI | InChI=1S/C20H46N4O5/c1-3-19(13-25-9-5-21,14-26-10-6-22)17-29-18-20(4-2,15-27-11-7-23)16-28-12-8-24/h3-18,21-24H2,1-2H3 |
| InChIKey | HCELFCHKBKPMKM-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 150.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|