About CID 58841248
CID 58841248 (PubChem CID 58841248) has the molecular formula C12H20O3
and a molecular weight of 212.29 g/mol.
Molecular Properties
| Compound Name | CID 58841248 |
| PubChem CID | 58841248 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | — |
| SMILES | [CH]COCC(CC)(COC[CH])COC[CH] |
| InChI | InChI=1S/C12H20O3/c1-5-12(9-13-6-2,10-14-7-3)11-15-8-4/h2-4H,5-11H2,1H3 |
| InChIKey | DFHVDGKUPRGCEE-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 58841248 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58841248?
The IUPAC name of CID 58841248 (CID 58841248) is not available.
What is the SMILES notation for CID 58841248?
The canonical SMILES for CID 58841248 is [CH]COCC(CC)(COC[CH])COC[CH].
What is the InChIKey of CID 58841248?
The InChIKey is DFHVDGKUPRGCEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O3/c1-5-12(9-13-6-2,10-14-7-3)11-15-8-4/h2-4H,5-11H2,1H3.
What are the key properties of CID 58841248?
CID 58841248 has a molecular weight of 212.29 g/mol, XLogP of 1.57, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58841248 is sourced from PubChem (CID 58841248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).