C30H48N2O8 — CID 155607756
(6S,7R,10S)-N-hydroxy-7-(2-methylpropyl)-8-oxo-10-[4-[2-(2-propoxyethoxy)ethoxy]butanoyl]-2-oxa-9-azabicyclo[10.2.2]hexadeca-1(14),12,15-triene-6-carboxamide (PubChem CID 155607756) has the molecular formula C30H48N2O8 and a molecular weight of 564.72 g/mol. Its IUPAC name is (6S,7R,10S)-N-hydroxy-7-(2-methylpropyl)-8-oxo-10-[4-[2-(2-propoxyethoxy)ethoxy]butanoyl]-2-oxa-9-azabicyclo[10.2.2]hexadeca-1(14),12,15-triene-6-carboxamide.
| Compound Name | (6S,7R,10S)-N-hydroxy-7-(2-methylpropyl)-8-oxo-10-[4-[2-(2-propoxyethoxy)ethoxy]butanoyl]-2-oxa-9-azabicyclo[10.2.2]hexadeca-1(14),12,15-triene-6-carboxamide |
|---|---|
| PubChem CID | 155607756 |
| Molecular Formula | C30H48N2O8 |
| Molecular Weight | 564.72 g/mol |
| Exact Mass | 564.34 |
| IUPAC Name | (6S,7R,10S)-N-hydroxy-7-(2-methylpropyl)-8-oxo-10-[4-[2-(2-propoxyethoxy)ethoxy]butanoyl]-2-oxa-9-azabicyclo[10.2.2]hexadeca-1(14),12,15-triene-6-carboxamide |
| SMILES | CCCOCCOCCOCCCC(=O)[C@@H]1Cc2ccc(cc2)OCCC[C@H](C(=O)NO)[C@@H](CC(C)C)C(=O)N1 |
| InChI | InChI=1S/C30H48N2O8/c1-4-13-37-16-18-39-19-17-38-14-6-8-28(33)27-21-23-9-11-24(12-10-23)40-15-5-7-25(30(35)32-36)26(20-22(2)3)29(34)31-27/h9-12,22,25-27,36H,4-8,13-21H2,1-3H3,(H,31,34)(H,32,35)/t25-,26+,27-/m0/s1 |
| InChIKey | PUSNWQOGFNMQIV-VJGNERBWSA-N |
| XLogP | 3.48 |
| TPSA | 132.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.72 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|